About (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one
(4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one (PubChem CID 11047924) has the molecular formula C19H15NO
and a molecular weight of 273.33 g/mol. Its IUPAC name is (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one.
Molecular Properties
| Compound Name | (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one |
| PubChem CID | 11047924 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one |
| SMILES | CC1=C(c2ccccc2)C2=N[C@H]3C=CC=C[C@H]3C2=CC1=O |
| InChI | InChI=1S/C19H15NO/c1-12-17(21)11-15-14-9-5-6-10-16(14)20-19(15)18(12)13-7-3-2-4-8-13/h2-11,14,16H,1H3/t14-,16-/m0/s1 |
| InChIKey | WNVPESFFLSKUMR-HOCLYGCPSA-N |
| XLogP | 3.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one?
The IUPAC name of (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one (CID 11047924) is (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one.
What is the SMILES notation for (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one?
The canonical SMILES for (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one is CC1=C(c2ccccc2)C2=N[C@H]3C=CC=C[C@H]3C2=CC1=O.
What is the InChIKey of (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one?
The InChIKey is WNVPESFFLSKUMR-HOCLYGCPSA-N. The full InChI is InChI=1S/C19H15NO/c1-12-17(21)11-15-14-9-5-6-10-16(14)20-19(15)18(12)13-7-3-2-4-8-13/h2-11,14,16H,1H3/t14-,16-/m0/s1.
What are the key properties of (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one?
(4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one has a molecular weight of 273.33 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4bS,8aS)-2-methyl-1-phenyl-4b,8a-dihydrocarbazol-3-one is sourced from PubChem (CID 11047924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).