About ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate
ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate (PubChem CID 110479329) has the molecular formula C13H14FNO4
and a molecular weight of 267.26 g/mol. Its IUPAC name is ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate |
| PubChem CID | 110479329 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate |
| SMILES | CCOC(=O)NC1CCOc2c(F)cccc2C1=O |
| InChI | InChI=1S/C13H14FNO4/c1-2-18-13(17)15-10-6-7-19-12-8(11(10)16)4-3-5-9(12)14/h3-5,10H,2,6-7H2,1H3,(H,15,17) |
| InChIKey | IXFDOUYXXXWRRM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate?
The IUPAC name of ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate (CID 110479329) is ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate.
What is the SMILES notation for ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate?
The canonical SMILES for ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate is CCOC(=O)NC1CCOc2c(F)cccc2C1=O.
What is the InChIKey of ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate?
The InChIKey is IXFDOUYXXXWRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO4/c1-2-18-13(17)15-10-6-7-19-12-8(11(10)16)4-3-5-9(12)14/h3-5,10H,2,6-7H2,1H3,(H,15,17).
What are the key properties of ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate?
ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate has a molecular weight of 267.26 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(9-fluoro-5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)carbamate is sourced from PubChem (CID 110479329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).