C11H17F3N2O2 — CID 110479376
1-[4-(dimethylamino)piperidin-1-yl]-4,4,4-trifluorobutane-1,3-dione (PubChem CID 110479376) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-[4-(dimethylamino)piperidin-1-yl]-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-[4-(dimethylamino)piperidin-1-yl]-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 110479376 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[4-(dimethylamino)piperidin-1-yl]-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CN(C)C1CCN(C(=O)CC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O2/c1-15(2)8-3-5-16(6-4-8)10(18)7-9(17)11(12,13)14/h8H,3-7H2,1-2H3 |
| InChIKey | PTKMTAOPBZJKPI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|