C8H6F3N3O4 — CID 110479399
5-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid (PubChem CID 110479399) has the molecular formula C8H6F3N3O4 and a molecular weight of 265.15 g/mol. Its IUPAC name is 5-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 110479399 |
| Molecular Formula | C8H6F3N3O4 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(CC(=O)C(F)(F)F)Nc1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C8H6F3N3O4/c9-8(10,11)4(15)1-5(16)13-6-3(7(17)18)2-12-14-6/h2H,1H2,(H,17,18)(H2,12,13,14,16) |
| InChIKey | FCOWHRVHJALJCP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|