C9H8F3N3O4 — CID 110479400
5-methyl-3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid (PubChem CID 110479400) has the molecular formula C9H8F3N3O4 and a molecular weight of 279.17 g/mol. Its IUPAC name is 5-methyl-3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 110479400 |
| Molecular Formula | C9H8F3N3O4 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-methyl-3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(NC(=O)CC(=O)C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C9H8F3N3O4/c1-3-6(8(18)19)7(15-14-3)13-5(17)2-4(16)9(10,11)12/h2H2,1H3,(H,18,19)(H2,13,14,15,17) |
| InChIKey | ZRXCJNNWLSMKNP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|