C20H36O7Si — CID 11047996
methyl (2S,3S,4aR,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate (PubChem CID 11047996) has the molecular formula C20H36O7Si and a molecular weight of 416.59 g/mol. Its IUPAC name is methyl (2S,3S,4aR,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl (2S,3S,4aR,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 11047996 |
| Molecular Formula | C20H36O7Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | methyl (2S,3S,4aR,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C(C)(C)C)C=C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2C1 |
| InChI | InChI=1S/C20H36O7Si/c1-17(2,3)28(9,10)27-20(16(21)22-6)12-11-14-15(13-20)26-19(5,24-8)18(4,23-7)25-14/h11-12,14-15H,13H2,1-10H3/t14-,15-,18+,19+,20+/m1/s1 |
| InChIKey | LRXRVDLRDBZFCJ-XEGUMIITSA-N |
| XLogP | 3.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|