C22H32O8 — CID 11048142
[(1S,2S,3R,7R,9E,11E,14R,16R)-18-hydroxy-2-methoxy-7,14-dimethyl-5,13-dioxo-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-dien-3-yl] acetate (PubChem CID 11048142) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(1S,2S,3R,7R,9E,11E,14R,16R)-18-hydroxy-2-methoxy-7,14-dimethyl-5,13-dioxo-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-dien-3-yl] acetate.
| Compound Name | [(1S,2S,3R,7R,9E,11E,14R,16R)-18-hydroxy-2-methoxy-7,14-dimethyl-5,13-dioxo-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-dien-3-yl] acetate |
|---|---|
| PubChem CID | 11048142 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(1S,2S,3R,7R,9E,11E,14R,16R)-18-hydroxy-2-methoxy-7,14-dimethyl-5,13-dioxo-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-dien-3-yl] acetate |
| SMILES | CO[C@@H]1[C@H]2OC(O)C[C@H]2C[C@@H](C)C(=O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O8/c1-13-10-16-11-19(25)30-21(16)22(27-4)18(29-15(3)23)12-20(26)28-14(2)8-6-5-7-9-17(13)24/h5-7,9,13-14,16,18-19,21-22,25H,8,10-12H2,1-4H3/b6-5+,9-7+/t13-,14-,16-,18-,19?,21+,22+/m1/s1 |
| InChIKey | JBTRLTRQFJMQGT-ONRKLMDLSA-N |
| XLogP | 2.09 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |