C25H38N4O2 — CID 11048196
2-[(1S)-1-[(4R,5R)-5-[(1S)-1-(2,2-dimethylhydrazinyl)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-1,1-dimethylhydrazine (PubChem CID 11048196) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 2-[(1S)-1-[(4R,5R)-5-[(1S)-1-(2,2-dimethylhydrazinyl)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(1S)-1-[(4R,5R)-5-[(1S)-1-(2,2-dimethylhydrazinyl)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 11048196 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 2-[(1S)-1-[(4R,5R)-5-[(1S)-1-(2,2-dimethylhydrazinyl)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)N[C@@H](Cc1ccccc1)[C@H]1OC(C)(C)O[C@@H]1[C@H](Cc1ccccc1)NN(C)C |
| InChI | InChI=1S/C25H38N4O2/c1-25(2)30-23(21(26-28(3)4)17-19-13-9-7-10-14-19)24(31-25)22(27-29(5)6)18-20-15-11-8-12-16-20/h7-16,21-24,26-27H,17-18H2,1-6H3/t21-,22-,23+,24+/m0/s1 |
| InChIKey | KBAVFTVYPKJHSA-CJRSTVEYSA-N |
| XLogP | 2.86 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|