C27H31N3O2 — CID 11048252
2-oxo-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide (PubChem CID 11048252) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-oxo-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide.
| Compound Name | 2-oxo-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide |
|---|---|
| PubChem CID | 11048252 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-oxo-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide |
| SMILES | NC(=O)c1ccc2c3c1CCCC3(CCCCN1CC=C(c3ccccc3)CC1)C(=O)N2 |
| InChI | InChI=1S/C27H31N3O2/c28-25(31)22-10-11-23-24-21(22)9-6-15-27(24,26(32)29-23)14-4-5-16-30-17-12-20(13-18-30)19-7-2-1-3-8-19/h1-3,7-8,10-12H,4-6,9,13-18H2,(H2,28,31)(H,29,32) |
| InChIKey | IXXLKQZULGARNF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|