About 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide
5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide (PubChem CID 110484124) has the molecular formula C8H14N4O3
and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 110484124 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide |
| SMILES | COC(CNC(=O)c1cn[nH]c1N)OC |
| InChI | InChI=1S/C8H14N4O3/c1-14-6(15-2)4-10-8(13)5-3-11-12-7(5)9/h3,6H,4H2,1-2H3,(H,10,13)(H3,9,11,12) |
| InChIKey | RHESINIACJHYMM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide (CID 110484124) is 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide is COC(CNC(=O)c1cn[nH]c1N)OC.
What is the InChIKey of 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide?
The InChIKey is RHESINIACJHYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O3/c1-14-6(15-2)4-10-8(13)5-3-11-12-7(5)9/h3,6H,4H2,1-2H3,(H,10,13)(H3,9,11,12).
What are the key properties of 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide?
5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide has a molecular weight of 214.23 g/mol, XLogP of -0.66, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,2-dimethoxyethyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 110484124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).