C11H16N2O2 — CID 110484596
2-(furan-2-yl)-N-piperidin-4-ylacetamide (PubChem CID 110484596) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-piperidin-4-ylacetamide.
| Compound Name | 2-(furan-2-yl)-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 110484596 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(furan-2-yl)-N-piperidin-4-ylacetamide |
| SMILES | O=C(Cc1ccco1)NC1CCNCC1 |
| InChI | InChI=1S/C11H16N2O2/c14-11(8-10-2-1-7-15-10)13-9-3-5-12-6-4-9/h1-2,7,9,12H,3-6,8H2,(H,13,14) |
| InChIKey | ZYULCALELOZDPY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |