C9H16N6O2 — CID 110484864
(5-amino-2H-triazol-4-yl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 110484864) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is (5-amino-2H-triazol-4-yl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (5-amino-2H-triazol-4-yl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110484864 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (5-amino-2H-triazol-4-yl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | Nc1n[nH]nc1C(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C9H16N6O2/c10-8-7(11-13-12-8)9(17)15-3-1-14(2-4-15)5-6-16/h16H,1-6H2,(H3,10,11,12,13) |
| InChIKey | SLDQRFRCIXSXJE-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |