About CTK1D3552
CTK1D3552 (PubChem CID 11048548) has the molecular formula C18H32SeSn
and a molecular weight of 446.13 g/mol.
Molecular Properties
| Compound Name | CTK1D3552 |
| PubChem CID | 11048548 |
| Molecular Formula | C18H32SeSn |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)CCCC.[Se]c1ccccc1 |
| InChI | InChI=1S/C6H5Se.3C4H9.Sn/c7-6-4-2-1-3-5-6;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | LMQBFNYUMNTGCA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CTK1D3552 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CTK1D3552?
The IUPAC name of CTK1D3552 (CID 11048548) is not available.
What is the SMILES notation for CTK1D3552?
The canonical SMILES for CTK1D3552 is CCCC[Sn](CCCC)CCCC.[Se]c1ccccc1.
What is the InChIKey of CTK1D3552?
The InChIKey is LMQBFNYUMNTGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Se.3C4H9.Sn/c7-6-4-2-1-3-5-6;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3;.
What are the key properties of CTK1D3552?
CTK1D3552 has a molecular weight of 446.13 g/mol, XLogP of 5.36, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CTK1D3552 is sourced from PubChem (CID 11048548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).