C25H38O5Si — CID 11048574
(1R,2R,7S,12S,15S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6-dione (PubChem CID 11048574) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (1R,2R,7S,12S,15S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2R,7S,12S,15S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 11048574 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (1R,2R,7S,12S,15S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6-dione |
| SMILES | CC1=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]4OC(C)(O)[C@@H](C)[C@@H]4[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C25H38O5Si/c1-13-10-17(26)16-12-18(30-31(8,9)23(3,4)5)15-11-19-20(14(2)25(7,28)29-19)21(15)24(16,6)22(13)27/h10,14,16,19-21,28H,11-12H2,1-9H3/t14-,16+,19-,20-,21-,24-,25?/m0/s1 |
| InChIKey | ZWXIYIWNGQDLEF-VIGVWRSTSA-N |
| XLogP | 4.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|