C24H19NO4S2 — CID 11048624
2-[[2,4-bis(benzenesulfonyl)phenyl]methyl]pyridine (PubChem CID 11048624) has the molecular formula C24H19NO4S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[[2,4-bis(benzenesulfonyl)phenyl]methyl]pyridine.
| Compound Name | 2-[[2,4-bis(benzenesulfonyl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 11048624 |
| Molecular Formula | C24H19NO4S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-[[2,4-bis(benzenesulfonyl)phenyl]methyl]pyridine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(Cc2ccccn2)c(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H19NO4S2/c26-30(27,21-10-3-1-4-11-21)23-15-14-19(17-20-9-7-8-16-25-20)24(18-23)31(28,29)22-12-5-2-6-13-22/h1-16,18H,17H2 |
| InChIKey | DVBCIHZWIGAWJF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |