C23H32O7S — CID 11048678
[(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-oxo-2-(phenylmethoxymethyl)-1-bicyclo[2.2.2]octanyl] methanesulfonate (PubChem CID 11048678) has the molecular formula C23H32O7S and a molecular weight of 452.57 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-oxo-2-(phenylmethoxymethyl)-1-bicyclo[2.2.2]octanyl] methanesulfonate.
| Compound Name | [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-oxo-2-(phenylmethoxymethyl)-1-bicyclo[2.2.2]octanyl] methanesulfonate |
|---|---|
| PubChem CID | 11048678 |
| Molecular Formula | C23H32O7S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-oxo-2-(phenylmethoxymethyl)-1-bicyclo[2.2.2]octanyl] methanesulfonate |
| SMILES | CC1(C)OC[C@H]([C@@H]2[C@@H](COCc3ccccc3)[C@]3(OS(C)(=O)=O)CC[C@@]2(C)C(=O)C3)O1 |
| InChI | InChI=1S/C23H32O7S/c1-21(2)28-15-18(29-21)20-17(14-27-13-16-8-6-5-7-9-16)23(30-31(4,25)26)11-10-22(20,3)19(24)12-23/h5-9,17-18,20H,10-15H2,1-4H3/t17-,18-,20+,22+,23+/m1/s1 |
| InChIKey | ANICTTVEQYTSGC-IYVPXIFYSA-N |
| XLogP | 3.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|