C25H44O5Si — CID 11048683
methyl (2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienoate (PubChem CID 11048683) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is methyl (2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienoate.
| Compound Name | methyl (2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienoate |
|---|---|
| PubChem CID | 11048683 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | methyl (2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](CO)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44O5Si/c1-18(2)31(19(3)4,20(5)6)30-23(14-12-21(7)13-15-25(27)28-8)16-22-10-9-11-24(17-26)29-22/h9-10,12-13,15,18-20,22-24,26H,11,14,16-17H2,1-8H3/b15-13+,21-12+/t22-,23-,24-/m0/s1 |
| InChIKey | MFVJHXVSLSUKRP-QYTOJLLQSA-N |
| XLogP | 5.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|