About (4-bromo-1,3-thiazol-2-yl)-tributylstannane
(4-bromo-1,3-thiazol-2-yl)-tributylstannane (PubChem CID 11048687) has the molecular formula C15H28BrNSSn
and a molecular weight of 453.08 g/mol. Its IUPAC name is (4-bromo-1,3-thiazol-2-yl)-tributylstannane.
Molecular Properties
| Compound Name | (4-bromo-1,3-thiazol-2-yl)-tributylstannane |
| PubChem CID | 11048687 |
| Molecular Formula | C15H28BrNSSn |
| Molecular Weight | 453.08 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | (4-bromo-1,3-thiazol-2-yl)-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nc(Br)cs1 |
| InChI | InChI=1S/3C4H9.C3HBrNS.Sn/c3*1-3-4-2;4-3-1-6-2-5-3;/h3*1,3-4H2,2H3;1H; |
| InChIKey | ZBBDCVVDIHDNRL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromo-1,3-thiazol-2-yl)-tributylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-1,3-thiazol-2-yl)-tributylstannane?
The IUPAC name of (4-bromo-1,3-thiazol-2-yl)-tributylstannane (CID 11048687) is (4-bromo-1,3-thiazol-2-yl)-tributylstannane.
What is the SMILES notation for (4-bromo-1,3-thiazol-2-yl)-tributylstannane?
The canonical SMILES for (4-bromo-1,3-thiazol-2-yl)-tributylstannane is CCCC[Sn](CCCC)(CCCC)c1nc(Br)cs1.
What is the InChIKey of (4-bromo-1,3-thiazol-2-yl)-tributylstannane?
The InChIKey is ZBBDCVVDIHDNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3HBrNS.Sn/c3*1-3-4-2;4-3-1-6-2-5-3;/h3*1,3-4H2,2H3;1H;.
What are the key properties of (4-bromo-1,3-thiazol-2-yl)-tributylstannane?
(4-bromo-1,3-thiazol-2-yl)-tributylstannane has a molecular weight of 453.08 g/mol, XLogP of 5.96, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-1,3-thiazol-2-yl)-tributylstannane is sourced from PubChem (CID 11048687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).