C30H30O4 — CID 11048714
(2R,3R)-1,4-dimethoxy-1,1,4,4-tetraphenylbutane-2,3-diol (PubChem CID 11048714) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2R,3R)-1,4-dimethoxy-1,1,4,4-tetraphenylbutane-2,3-diol.
| Compound Name | (2R,3R)-1,4-dimethoxy-1,1,4,4-tetraphenylbutane-2,3-diol |
|---|---|
| PubChem CID | 11048714 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (2R,3R)-1,4-dimethoxy-1,1,4,4-tetraphenylbutane-2,3-diol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@H](O)[C@@H](O)C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30O4/c1-33-29(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27(31)28(32)30(34-2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28,31-32H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | AXJXOZFACYIMBU-VSGBNLITSA-N |
| XLogP | 4.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |