C28H42O3Si — CID 11048723
3-[(9R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-13-methyl-11,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-9-yl]propanal (PubChem CID 11048723) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is 3-[(9R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-13-methyl-11,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-9-yl]propanal.
| Compound Name | 3-[(9R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-13-methyl-11,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-9-yl]propanal |
|---|---|
| PubChem CID | 11048723 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 3-[(9R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-13-methyl-11,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-9-yl]propanal |
| SMILES | COc1ccc2c(c1)CC=C1[C@@H]3CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC[C@@]12CCC=O |
| InChI | InChI=1S/C28H42O3Si/c1-26(2,3)32(6,7)31-25-14-13-23-24-11-9-20-19-21(30-5)10-12-22(20)28(24,15-8-18-29)17-16-27(23,25)4/h10-12,18-19,23,25H,8-9,13-17H2,1-7H3/t23-,25-,27-,28+/m0/s1 |
| InChIKey | LKWZFQGUZSISOF-OEAWUUHTSA-N |
| XLogP | 7.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|