C28H29N2O2P — CID 11048741
phenyl-bis[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethyl]phosphane (PubChem CID 11048741) has the molecular formula C28H29N2O2P and a molecular weight of 456.53 g/mol. Its IUPAC name is phenyl-bis[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethyl]phosphane.
| Compound Name | phenyl-bis[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethyl]phosphane |
|---|---|
| PubChem CID | 11048741 |
| Molecular Formula | C28H29N2O2P |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | phenyl-bis[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethyl]phosphane |
| SMILES | c1ccc([C@@H]2COC(CCP(CCC3=N[C@H](c4ccccc4)CO3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C28H29N2O2P/c1-4-10-22(11-5-1)25-20-31-27(29-25)16-18-33(24-14-8-3-9-15-24)19-17-28-30-26(21-32-28)23-12-6-2-7-13-23/h1-15,25-26H,16-21H2/t25-,26-/m0/s1 |
| InChIKey | OUPLQIVEABYSGJ-UIOOFZCWSA-N |
| XLogP | 5.91 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|