C25H23N5O4 — CID 11048767
4-methyl-17,20-dioxa-4,12,14,23,25-pentazahexacyclo[21.6.1.17,14.02,6.08,13.024,29]hentriaconta-1(30),2(6),7(31),8(13),9,11,24(29),25,27-nonaene-3,5-dione (PubChem CID 11048767) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-methyl-17,20-dioxa-4,12,14,23,25-pentazahexacyclo[21.6.1.17,14.02,6.08,13.024,29]hentriaconta-1(30),2(6),7(31),8(13),9,11,24(29),25,27-nonaene-3,5-dione.
| Compound Name | 4-methyl-17,20-dioxa-4,12,14,23,25-pentazahexacyclo[21.6.1.17,14.02,6.08,13.024,29]hentriaconta-1(30),2(6),7(31),8(13),9,11,24(29),25,27-nonaene-3,5-dione |
|---|---|
| PubChem CID | 11048767 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-methyl-17,20-dioxa-4,12,14,23,25-pentazahexacyclo[21.6.1.17,14.02,6.08,13.024,29]hentriaconta-1(30),2(6),7(31),8(13),9,11,24(29),25,27-nonaene-3,5-dione |
| SMILES | CN1C(=O)C2=C(C1=O)c1cn(c3ncccc13)CCOCCOCCn1cc2c2cccnc21 |
| InChI | InChI=1S/C25H23N5O4/c1-28-24(31)20-18-14-29(22-16(18)4-2-6-26-22)8-10-33-12-13-34-11-9-30-15-19(21(20)25(28)32)17-5-3-7-27-23(17)30/h2-7,14-15H,8-13H2,1H3 |
| InChIKey | POVUXLRBOJKSAI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|