About (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate
(3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 11048769) has the molecular formula C27H27N3O4
and a molecular weight of 457.53 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 11048769 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OCc1cccc(Oc2ccccc2)c1)N1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c31-25-27(30(20-28-25)22-9-3-1-4-10-22)14-16-29(17-15-27)26(32)33-19-21-8-7-13-24(18-21)34-23-11-5-2-6-12-23/h1-13,18H,14-17,19-20H2,(H,28,31) |
| InChIKey | GXLMYIVPJMIMFS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The IUPAC name of (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CID 11048769) is (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate is O=C(OCc1cccc(Oc2ccccc2)c1)N1CCC2(CC1)C(=O)NCN2c1ccccc1.
What is the InChIKey of (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The InChIKey is GXLMYIVPJMIMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27N3O4/c31-25-27(30(20-28-25)22-9-3-1-4-10-22)14-16-29(17-15-27)26(32)33-19-21-8-7-13-24(18-21)34-23-11-5-2-6-12-23/h1-13,18H,14-17,19-20H2,(H,28,31).
What are the key properties of (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
(3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate has a molecular weight of 457.53 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 11048769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).