C28H33ClN4 — CID 11048825
1,1-dibutyl-6-chloro-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11048825) has the molecular formula C28H33ClN4 and a molecular weight of 461.05 g/mol. Its IUPAC name is 1,1-dibutyl-6-chloro-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1,1-dibutyl-6-chloro-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11048825 |
| Molecular Formula | C28H33ClN4 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1,1-dibutyl-6-chloro-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCC1(CCCC)NC(c2ncc(-c3ccccc3)[nH]2)Cc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C28H33ClN4/c1-3-5-14-28(15-6-4-2)26-22(21-16-20(29)12-13-23(21)31-26)17-24(33-28)27-30-18-25(32-27)19-10-8-7-9-11-19/h7-13,16,18,24,31,33H,3-6,14-15,17H2,1-2H3,(H,30,32) |
| InChIKey | DBLQQFZKWOTGKW-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |