C14H17F2NO — CID 110488890
2-(2,4-difluorophenyl)-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 110488890) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-(2,4-difluorophenyl)-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 110488890 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCN(C(=O)Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H17F2NO/c1-10-3-2-6-17(9-10)14(18)7-11-4-5-12(15)8-13(11)16/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | BUZFLZBRAUVBRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |