C16H16N2O2 — CID 110489199
N-(3-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-8-carboxamide (PubChem CID 110489199) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-8-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 110489199 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(3-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-8-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1cccc2c1CNCC2 |
| InChI | InChI=1S/C16H16N2O2/c19-13-5-2-4-12(9-13)18-16(20)14-6-1-3-11-7-8-17-10-15(11)14/h1-6,9,17,19H,7-8,10H2,(H,18,20) |
| InChIKey | SIXCEGDPMBPGIY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |