About 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide
3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide (PubChem CID 110490640) has the molecular formula C12H14ClN5O
and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide |
| PubChem CID | 110490640 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide |
| SMILES | CC(C)(NC(=O)n1cnc(N)n1)c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClN5O/c1-12(2,8-5-3-4-6-9(8)13)16-11(19)18-7-15-10(14)17-18/h3-7H,1-2H3,(H2,14,17)(H,16,19) |
| InChIKey | LGTIRWRVVQDZHW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide?
The IUPAC name of 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide (CID 110490640) is 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide is CC(C)(NC(=O)n1cnc(N)n1)c1ccccc1Cl.
What is the InChIKey of 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide?
The InChIKey is LGTIRWRVVQDZHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN5O/c1-12(2,8-5-3-4-6-9(8)13)16-11(19)18-7-15-10(14)17-18/h3-7H,1-2H3,(H2,14,17)(H,16,19).
What are the key properties of 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide?
3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide has a molecular weight of 279.73 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[2-(2-chlorophenyl)propan-2-yl]-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 110490640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).