About [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate
[12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate (PubChem CID 11049111) has the molecular formula C24H14F6O4
and a molecular weight of 480.36 g/mol. Its IUPAC name is [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate.
Molecular Properties
| Compound Name | [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate |
| PubChem CID | 11049111 |
| Molecular Formula | C24H14F6O4 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate |
| SMILES | CC(=O)Oc1c2cc(C(F)(F)F)c(C(F)(F)F)cc2c(OC(C)=O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C24H14F6O4/c1-11(31)33-21-15-7-13-5-3-4-6-14(13)8-16(15)22(34-12(2)32)18-10-20(24(28,29)30)19(9-17(18)21)23(25,26)27/h3-10H,1-2H3 |
| InChIKey | JLNBUCYYFXVRIJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate?
The IUPAC name of [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate (CID 11049111) is [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate.
What is the SMILES notation for [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate?
The canonical SMILES for [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate is CC(=O)Oc1c2cc(C(F)(F)F)c(C(F)(F)F)cc2c(OC(C)=O)c2cc3ccccc3cc12.
What is the InChIKey of [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate?
The InChIKey is JLNBUCYYFXVRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F6O4/c1-11(31)33-21-15-7-13-5-3-4-6-14(13)8-16(15)22(34-12(2)32)18-10-20(24(28,29)30)19(9-17(18)21)23(25,26)27/h3-10H,1-2H3.
What are the key properties of [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate?
[12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate has a molecular weight of 480.36 g/mol, XLogP of 7.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [12-acetyloxy-2,3-bis(trifluoromethyl)tetracen-5-yl] acetate is sourced from PubChem (CID 11049111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).