C14H11FN2O2 — CID 110491210
6-fluoro-3-(4-hydroxy-2-methylphenyl)-1H-benzimidazol-2-one (PubChem CID 110491210) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is 6-fluoro-3-(4-hydroxy-2-methylphenyl)-1H-benzimidazol-2-one.
| Compound Name | 6-fluoro-3-(4-hydroxy-2-methylphenyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 110491210 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 6-fluoro-3-(4-hydroxy-2-methylphenyl)-1H-benzimidazol-2-one |
| SMILES | Cc1cc(O)ccc1-n1c(=O)[nH]c2cc(F)ccc21 |
| InChI | InChI=1S/C14H11FN2O2/c1-8-6-10(18)3-5-12(8)17-13-4-2-9(15)7-11(13)16-14(17)19/h2-7,18H,1H3,(H,16,19) |
| InChIKey | XXNDYHJRBQVMHU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |