About 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one
3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one (PubChem CID 110491329) has the molecular formula C14H16F2N2O
and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one |
| PubChem CID | 110491329 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(F)c(F)c2n1C1CCCCCC1 |
| InChI | InChI=1S/C14H16F2N2O/c15-10-7-8-11-13(12(10)16)18(14(19)17-11)9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,17,19) |
| InChIKey | YJERCRRFIODEOD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one?
The IUPAC name of 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one (CID 110491329) is 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one.
What is the SMILES notation for 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one?
The canonical SMILES for 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one is O=c1[nH]c2ccc(F)c(F)c2n1C1CCCCCC1.
What is the InChIKey of 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one?
The InChIKey is YJERCRRFIODEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2O/c15-10-7-8-11-13(12(10)16)18(14(19)17-11)9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,17,19).
What are the key properties of 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one?
3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one has a molecular weight of 266.29 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyl-4,5-difluoro-1H-benzimidazol-2-one is sourced from PubChem (CID 110491329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).