C11H13N5OS — CID 110492290
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-pyrazin-2-ylurea (PubChem CID 110492290) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-pyrazin-2-ylurea.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 110492290 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-pyrazin-2-ylurea |
| SMILES | Cc1nc(CNC(=O)Nc2cnccn2)sc1C |
| InChI | InChI=1S/C11H13N5OS/c1-7-8(2)18-10(15-7)6-14-11(17)16-9-5-12-3-4-13-9/h3-5H,6H2,1-2H3,(H2,13,14,16,17) |
| InChIKey | AQXZAGBXWNBLCU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |