C33H32O4 — CID 11049278
1-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]propan-2-one (PubChem CID 11049278) has the molecular formula C33H32O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]propan-2-one.
| Compound Name | 1-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 11049278 |
| Molecular Formula | C33H32O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C33H32O4/c1-25(34)22-30-23-31(37-32(36-30)26-14-6-2-7-15-26)24-35-33(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,30-32H,22-24H2,1H3/t30-,31-,32-/m1/s1 |
| InChIKey | JODRCZAQNNDMSP-XWHIBYANSA-N |
| XLogP | 6.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|