C28H52O3Si2 — CID 11049283
[(2E,6S)-6-[(1S,5aR)-3,3,5,5,8-pentamethyl-1,5a,6,7-tetrahydrocyclopenta[e][1,3,2]dioxasilepin-1-yl]-2,6-dimethylocta-2,7-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11049283) has the molecular formula C28H52O3Si2 and a molecular weight of 492.89 g/mol. Its IUPAC name is [(2E,6S)-6-[(1S,5aR)-3,3,5,5,8-pentamethyl-1,5a,6,7-tetrahydrocyclopenta[e][1,3,2]dioxasilepin-1-yl]-2,6-dimethylocta-2,7-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E,6S)-6-[(1S,5aR)-3,3,5,5,8-pentamethyl-1,5a,6,7-tetrahydrocyclopenta[e][1,3,2]dioxasilepin-1-yl]-2,6-dimethylocta-2,7-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11049283 |
| Molecular Formula | C28H52O3Si2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | [(2E,6S)-6-[(1S,5aR)-3,3,5,5,8-pentamethyl-1,5a,6,7-tetrahydrocyclopenta[e][1,3,2]dioxasilepin-1-yl]-2,6-dimethylocta-2,7-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@](C)(CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)OC(C)(C)[C@@H]2CCC(C)=C21 |
| InChI | InChI=1S/C28H52O3Si2/c1-14-28(9,19-15-16-21(2)20-29-32(10,11)26(4,5)6)25-24-22(3)17-18-23(24)27(7,8)31-33(12,13)30-25/h14,16,23,25H,1,15,17-20H2,2-13H3/b21-16+/t23-,25-,28-/m1/s1 |
| InChIKey | JCCOTZCCAHWOMH-NDBQVDCGSA-N |
| XLogP | 8.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|