C18H22N4O5 — CID 110494068
8-(2-methyl-3-nitrobenzoyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110494068) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 8-(2-methyl-3-nitrobenzoyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-methyl-3-nitrobenzoyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110494068 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 8-(2-methyl-3-nitrobenzoyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1c(C(=O)N2CCC3(CC2)NC(=O)N(C(C)C)C3=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5/c1-11(2)21-16(24)18(19-17(21)25)7-9-20(10-8-18)15(23)13-5-4-6-14(12(13)3)22(26)27/h4-6,11H,7-10H2,1-3H3,(H,19,25) |
| InChIKey | UFVWHCJNIIYGNQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|