C16H19ClN4O3 — CID 110494071
8-(2-chloropyridine-4-carbonyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110494071) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is 8-(2-chloropyridine-4-carbonyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-chloropyridine-4-carbonyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110494071 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 8-(2-chloropyridine-4-carbonyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)N1C(=O)NC2(CCN(C(=O)c3ccnc(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C16H19ClN4O3/c1-10(2)21-14(23)16(19-15(21)24)4-7-20(8-5-16)13(22)11-3-6-18-12(17)9-11/h3,6,9-10H,4-5,7-8H2,1-2H3,(H,19,24) |
| InChIKey | LIBYLRLTLBXTCG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|