About 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate
1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate (PubChem CID 110494296) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate.
Molecular Properties
| Compound Name | 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate |
| PubChem CID | 110494296 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(C)c1OCC(=O)Oc1ccc2ocnc2c1 |
| InChI | InChI=1S/C17H15NO4/c1-11-4-3-5-12(2)17(11)20-9-16(19)22-13-6-7-15-14(8-13)18-10-21-15/h3-8,10H,9H2,1-2H3 |
| InChIKey | BHRDKTWQIQDFRU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate?
The IUPAC name of 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate (CID 110494296) is 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate.
What is the SMILES notation for 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate?
The canonical SMILES for 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate is Cc1cccc(C)c1OCC(=O)Oc1ccc2ocnc2c1.
What is the InChIKey of 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate?
The InChIKey is BHRDKTWQIQDFRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-11-4-3-5-12(2)17(11)20-9-16(19)22-13-6-7-15-14(8-13)18-10-21-15/h3-8,10H,9H2,1-2H3.
What are the key properties of 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate?
1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate has a molecular weight of 297.31 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazol-5-yl 2-(2,6-dimethylphenoxy)acetate is sourced from PubChem (CID 110494296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).