C30H26N4O4 — CID 11049430
1-(1,3-benzodioxol-5-yl)-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11049430) has the molecular formula C30H26N4O4 and a molecular weight of 506.56 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11049430 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc(-c2cnc(N3CCc4c([nH]c5ccccc45)C3c3ccc4c(c3)OCO4)nc2)cc1OC |
| InChI | InChI=1S/C30H26N4O4/c1-35-24-9-7-18(13-26(24)36-2)20-15-31-30(32-16-20)34-12-11-22-21-5-3-4-6-23(21)33-28(22)29(34)19-8-10-25-27(14-19)38-17-37-25/h3-10,13-16,29,33H,11-12,17H2,1-2H3 |
| InChIKey | DQBJCYDEYXHIFJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|