About 1,3-benzoxazol-5-yl tert-butyl carbonate
1,3-benzoxazol-5-yl tert-butyl carbonate (PubChem CID 110494363) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is 1,3-benzoxazol-5-yl tert-butyl carbonate.
Molecular Properties
| Compound Name | 1,3-benzoxazol-5-yl tert-butyl carbonate |
| PubChem CID | 110494363 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1,3-benzoxazol-5-yl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2ocnc2c1 |
| InChI | InChI=1S/C12H13NO4/c1-12(2,3)17-11(14)16-8-4-5-10-9(6-8)13-7-15-10/h4-7H,1-3H3 |
| InChIKey | VIKVKBOXCXHMRK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzoxazol-5-yl tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazol-5-yl tert-butyl carbonate?
The IUPAC name of 1,3-benzoxazol-5-yl tert-butyl carbonate (CID 110494363) is 1,3-benzoxazol-5-yl tert-butyl carbonate.
What is the SMILES notation for 1,3-benzoxazol-5-yl tert-butyl carbonate?
The canonical SMILES for 1,3-benzoxazol-5-yl tert-butyl carbonate is CC(C)(C)OC(=O)Oc1ccc2ocnc2c1.
What is the InChIKey of 1,3-benzoxazol-5-yl tert-butyl carbonate?
The InChIKey is VIKVKBOXCXHMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-12(2,3)17-11(14)16-8-4-5-10-9(6-8)13-7-15-10/h4-7H,1-3H3.
What are the key properties of 1,3-benzoxazol-5-yl tert-butyl carbonate?
1,3-benzoxazol-5-yl tert-butyl carbonate has a molecular weight of 235.24 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazol-5-yl tert-butyl carbonate is sourced from PubChem (CID 110494363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).