C25H54O5Si3 — CID 11049597
1-[(2S,3R)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]oxiran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone (PubChem CID 11049597) has the molecular formula C25H54O5Si3 and a molecular weight of 518.96 g/mol. Its IUPAC name is 1-[(2S,3R)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]oxiran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone.
| Compound Name | 1-[(2S,3R)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]oxiran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone |
|---|---|
| PubChem CID | 11049597 |
| Molecular Formula | C25H54O5Si3 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 1-[(2S,3R)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]oxiran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O5Si3/c1-18(29-32(13,14)24(5,6)7)20(30-33(15,16)25(8,9)10)22-21(28-22)19(26)17-27-31(11,12)23(2,3)4/h18,20-22H,17H2,1-16H3/t18-,20+,21+,22-/m0/s1 |
| InChIKey | KKVIORAZCPWVTK-PDGJWGCVSA-N |
| XLogP | 7.15 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|