C28H16Cl4N2 — CID 11049629
2,2,3,3-tetrakis(4-chlorophenyl)butanedinitrile (PubChem CID 11049629) has the molecular formula C28H16Cl4N2 and a molecular weight of 522.26 g/mol. Its IUPAC name is 2,2,3,3-tetrakis(4-chlorophenyl)butanedinitrile.
| Compound Name | 2,2,3,3-tetrakis(4-chlorophenyl)butanedinitrile |
|---|---|
| PubChem CID | 11049629 |
| Molecular Formula | C28H16Cl4N2 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | 2,2,3,3-tetrakis(4-chlorophenyl)butanedinitrile |
| SMILES | N#CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(C#N)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H16Cl4N2/c29-23-9-1-19(2-10-23)27(17-33,20-3-11-24(30)12-4-20)28(18-34,21-5-13-25(31)14-6-21)22-7-15-26(32)16-8-22/h1-16H |
| InChIKey | NCBHHBFIZJRUBJ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |