C22H25N3O2S — CID 110496514
3-benzyl-N-cycloheptyl-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 110496514) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-benzyl-N-cycloheptyl-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-benzyl-N-cycloheptyl-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110496514 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-benzyl-N-cycloheptyl-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCCCCC2)sc2ncn(Cc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C22H25N3O2S/c1-15-18-21(23-14-25(22(18)27)13-16-9-5-4-6-10-16)28-19(15)20(26)24-17-11-7-2-3-8-12-17/h4-6,9-10,14,17H,2-3,7-8,11-13H2,1H3,(H,24,26) |
| InChIKey | GFUQZMLXZPOGKO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |