C14H20N2O5 — CID 110496619
2-[(3-amino-4-propoxybenzoyl)amino]-3-hydroxybutanoic acid (PubChem CID 110496619) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(3-amino-4-propoxybenzoyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(3-amino-4-propoxybenzoyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 110496619 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[(3-amino-4-propoxybenzoyl)amino]-3-hydroxybutanoic acid |
| SMILES | CCCOc1ccc(C(=O)NC(C(=O)O)C(C)O)cc1N |
| InChI | InChI=1S/C14H20N2O5/c1-3-6-21-11-5-4-9(7-10(11)15)13(18)16-12(8(2)17)14(19)20/h4-5,7-8,12,17H,3,6,15H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | ICMXUVDRQOIYNR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|