C24H38O5Sn — CID 11049669
methyl (3S,3aR,6aS)-5',5'-dimethyl-2-oxo-3-[(2-trimethylstannylcyclopenten-1-yl)methyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1-carboxylate (PubChem CID 11049669) has the molecular formula C24H38O5Sn and a molecular weight of 525.27 g/mol. Its IUPAC name is methyl (3S,3aR,6aS)-5',5'-dimethyl-2-oxo-3-[(2-trimethylstannylcyclopenten-1-yl)methyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1-carboxylate.
| Compound Name | methyl (3S,3aR,6aS)-5',5'-dimethyl-2-oxo-3-[(2-trimethylstannylcyclopenten-1-yl)methyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1-carboxylate |
|---|---|
| PubChem CID | 11049669 |
| Molecular Formula | C24H38O5Sn |
| Molecular Weight | 525.27 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | methyl (3S,3aR,6aS)-5',5'-dimethyl-2-oxo-3-[(2-trimethylstannylcyclopenten-1-yl)methyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1-carboxylate |
| SMILES | COC(=O)C1C(=O)[C@@H](CC2=C([Sn](C)(C)C)CCC2)[C@@H]2CC3(C[C@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C21H29O5.3CH3.Sn/c1-20(2)11-25-21(26-12-20)9-15-14(8-13-6-4-5-7-13)18(22)17(16(15)10-21)19(23)24-3;;;;/h14-17H,4-6,8-12H2,1-3H3;3*1H3;/t14-,15-,16-,17?;;;;/m0..../s1 |
| InChIKey | SPXQAQUDIAWOSW-UCQBBBHASA-N |
| XLogP | 4.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|