C24H34BrNO5S — CID 11049698
[(1S,3R,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;(1R,9R,13R)-1,13-dimethyl-10-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol (PubChem CID 11049698) has the molecular formula C24H34BrNO5S and a molecular weight of 528.51 g/mol. Its IUPAC name is [(1S,3R,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;(1R,9R,13R)-1,13-dimethyl-10-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol.
| Compound Name | [(1S,3R,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;(1R,9R,13R)-1,13-dimethyl-10-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol |
|---|---|
| PubChem CID | 11049698 |
| Molecular Formula | C24H34BrNO5S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [(1S,3R,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;(1R,9R,13R)-1,13-dimethyl-10-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)[O-])C(=O)[C@@H]2Br.C[C@H]1[C@H]2Cc3cc(O)ccc3[C@]1(C)CC[NH2+]2 |
| InChI | InChI=1S/C14H19NO.C10H15BrO4S/c1-9-13-8-10-7-11(16)3-4-12(10)14(9,2)5-6-15-13;1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11/h3-4,7,9,13,15-16H,5-6,8H2,1-2H3;6-7H,3-5H2,1-2H3,(H,13,14,15)/t9-,13+,14+;6-,7-,10-/m01/s1 |
| InChIKey | WVWPPBMDZNOWJG-ZYALOYKNSA-N |
| XLogP | 2.48 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|