C36H32O4 — CID 11049704
4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1,6-dimethyl-9,10-dihydrophenanthren-3-yl)-3,8-dimethylphenanthrene-2,7-diol (PubChem CID 11049704) has the molecular formula C36H32O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1,6-dimethyl-9,10-dihydrophenanthren-3-yl)-3,8-dimethylphenanthrene-2,7-diol.
| Compound Name | 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1,6-dimethyl-9,10-dihydrophenanthren-3-yl)-3,8-dimethylphenanthrene-2,7-diol |
|---|---|
| PubChem CID | 11049704 |
| Molecular Formula | C36H32O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1,6-dimethyl-9,10-dihydrophenanthren-3-yl)-3,8-dimethylphenanthrene-2,7-diol |
| SMILES | C=Cc1c(C)c(O)cc2c1-c1cc(-c3c(O)c(C)c(C=C)c4c3ccc3c(C)c(O)ccc34)c(O)c(C)c1CC2 |
| InChI | InChI=1S/C36H32O4/c1-7-22-17(3)31(38)15-21-9-10-25-20(6)35(39)29(16-28(25)32(21)22)34-27-12-11-24-18(4)30(37)14-13-26(24)33(27)23(8-2)19(5)36(34)40/h7-8,11-16,37-40H,1-2,9-10H2,3-6H3 |
| InChIKey | PJKMCGOFBBHUDB-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|