C27H58O4Si3 — CID 11049724
tert-butyl-dimethyl-[(1R)-1-[(2S,3R)-3-methyl-3-(2-methyl-1-trimethylsilyloxyprop-2-enyl)oxiran-2-yl]-2-tri(propan-2-yl)silyloxyethoxy]silane (PubChem CID 11049724) has the molecular formula C27H58O4Si3 and a molecular weight of 531.02 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-1-[(2S,3R)-3-methyl-3-(2-methyl-1-trimethylsilyloxyprop-2-enyl)oxiran-2-yl]-2-tri(propan-2-yl)silyloxyethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-1-[(2S,3R)-3-methyl-3-(2-methyl-1-trimethylsilyloxyprop-2-enyl)oxiran-2-yl]-2-tri(propan-2-yl)silyloxyethoxy]silane |
|---|---|
| PubChem CID | 11049724 |
| Molecular Formula | C27H58O4Si3 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-1-[(2S,3R)-3-methyl-3-(2-methyl-1-trimethylsilyloxyprop-2-enyl)oxiran-2-yl]-2-tri(propan-2-yl)silyloxyethoxy]silane |
| SMILES | C=C(C)C(O[Si](C)(C)C)[C@]1(C)O[C@H]1[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H58O4Si3/c1-19(2)24(31-32(13,14)15)27(12)25(29-27)23(30-33(16,17)26(9,10)11)18-28-34(20(3)4,21(5)6)22(7)8/h20-25H,1,18H2,2-17H3/t23-,24?,25+,27+/m1/s1 |
| InChIKey | RUPPOXXTHVARCH-PDNXYAFSSA-N |
| XLogP | 8.52 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|