C35H40N4O — CID 11049745
1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11049745) has the molecular formula C35H40N4O and a molecular weight of 532.73 g/mol. Its IUPAC name is 1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11049745 |
| Molecular Formula | C35H40N4O |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCC1(CCCC)NC(c2ncc(-c3ccccc3)[nH]2)Cc2c1[nH]c1ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C35H40N4O/c1-3-5-19-35(20-6-4-2)33-29(22-31(39-35)34-36-23-32(38-34)26-15-11-8-12-16-26)28-21-27(17-18-30(28)37-33)40-24-25-13-9-7-10-14-25/h7-18,21,23,31,37,39H,3-6,19-20,22,24H2,1-2H3,(H,36,38) |
| InChIKey | FDJQARYJQHXLKI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |