C20H30N2O3 — CID 110498665
1-butyl-N,N-bis(2-methoxyethyl)-3-methylindole-2-carboxamide (PubChem CID 110498665) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-butyl-N,N-bis(2-methoxyethyl)-3-methylindole-2-carboxamide.
| Compound Name | 1-butyl-N,N-bis(2-methoxyethyl)-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110498665 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-butyl-N,N-bis(2-methoxyethyl)-3-methylindole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)N(CCOC)CCOC)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H30N2O3/c1-5-6-11-22-18-10-8-7-9-17(18)16(2)19(22)20(23)21(12-14-24-3)13-15-25-4/h7-10H,5-6,11-15H2,1-4H3 |
| InChIKey | RRXGBUJYXMDOSH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|