C25H30N2O3 — CID 110498870
ethyl 2-[benzyl-(1,5-diethyl-3-methylindole-2-carbonyl)amino]acetate (PubChem CID 110498870) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 2-[benzyl-(1,5-diethyl-3-methylindole-2-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[benzyl-(1,5-diethyl-3-methylindole-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 110498870 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | ethyl 2-[benzyl-(1,5-diethyl-3-methylindole-2-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(=O)c1c(C)c2cc(CC)ccc2n1CC |
| InChI | InChI=1S/C25H30N2O3/c1-5-19-13-14-22-21(15-19)18(4)24(27(22)6-2)25(29)26(17-23(28)30-7-3)16-20-11-9-8-10-12-20/h8-15H,5-7,16-17H2,1-4H3 |
| InChIKey | XTPYWAJPNXSBSW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|