About (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid
(2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 11049998) has the molecular formula C25H23Br2NO4
and a molecular weight of 561.27 g/mol. Its IUPAC name is (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid.
Molecular Properties
| Compound Name | (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid |
| PubChem CID | 11049998 |
| Molecular Formula | C25H23Br2NO4 |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCCn2c3ccc(Br)cc3c3cc(Br)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C25H23Br2NO4/c1-2-31-24(25(29)30)13-16-3-7-19(8-4-16)32-12-11-28-22-9-5-17(26)14-20(22)21-15-18(27)6-10-23(21)28/h3-10,14-15,24H,2,11-13H2,1H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | MFNINLDQACVMCQ-DEOSSOPVSA-N |
| XLogP | 6.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid?
The IUPAC name of (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid (CID 11049998) is (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid.
What is the SMILES notation for (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid?
The canonical SMILES for (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid is CCO[C@@H](Cc1ccc(OCCn2c3ccc(Br)cc3c3cc(Br)ccc32)cc1)C(=O)O.
What is the InChIKey of (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid?
The InChIKey is MFNINLDQACVMCQ-DEOSSOPVSA-N. The full InChI is InChI=1S/C25H23Br2NO4/c1-2-31-24(25(29)30)13-16-3-7-19(8-4-16)32-12-11-28-22-9-5-17(26)14-20(22)21-15-18(27)6-10-23(21)28/h3-10,14-15,24H,2,11-13H2,1H3,(H,29,30)/t24-/m0/s1.
What are the key properties of (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid?
(2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid has a molecular weight of 561.27 g/mol, XLogP of 6.43, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-[4-[2-(3,6-dibromocarbazol-9-yl)ethoxy]phenyl]-2-ethoxypropanoic acid is sourced from PubChem (CID 11049998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).